dl-leucine; (±)-leucine
| Name(s) | dl-leucine; (±)-leucine |
|---|---|
| Scientific name(s) | |
| Formula | C6H13NO2 |
| Molecular mass | 131.1729 |
| IUPAC name | 2-amino-4-methylpentanoic acid |
| INCHI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
| SMILE | CC(C)CC(N)C(O)=O |
| CAS ID | 328-39-2 |
| PubChem ID | 857 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Dietary supplement, nutrient [DFC]. (±)-Leucine is found in many foods, some of which are green bell pepper, italian sweet red pepper, green zucchini, and red bell pepper. |
|---|