| Name(s) | [7]-gingerol |
|---|---|
| Scientific name(s) | |
| Formula | C18H28O4 |
| Molecular mass | 308.4125 |
| IUPAC name | 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)undecan-3-one |
| INCHI | InChI=1S/C18H28O4/c1-3-4-5-6-7-15(19)13-16(20)10-8-14-9-11-17(21)18(12-14)22-2/h9,11-12,15,19,21H,3-8,10,13H2,1-2H3 |
| SMILE | CCCCCCC(O)CC(=O)CCC1=CC=C(O)C(OC)=C1 |
| CAS ID | 748159-27-5 |
| PubChem ID | Not available |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | [7]-gingerol is a member of the class of compounds known as gingerols. Gingerols are compounds containing a gingerol moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by a 5-hydroxy-alkane-3-one. [7]-gingerol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [7]-gingerol can be found in ginger, which makes [7]-gingerol a potential biomarker for the consumption of this food product. |
|---|