malvidin 3-o-glucoside; malvidin 3-glucoside
| Name(s) | malvidin 3-o-glucoside; malvidin 3-glucoside |
|---|---|
| Scientific name(s) | |
| Formula | C23H25O12+ |
| Molecular mass | 493.441 |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-3-{[(2s,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1$l^{4}-chromen-1-ylium |
| INCHI | InChI=1S/C23H24O12/c1-31-14-3-9(4-15(32-2)18(14)27)22-16(7-11-12(26)5-10(25)6-13(11)33-22)34-23-21(30)20(29)19(28)17(8-24)35-23/h3-7,17,19-21,23-24,28-30H,8H2,1-2H3,(H2-,25,26,27)/p+1/t17-,19-,20+,21-,23-/m1/s1 |
| SMILE | COC1=CC(=CC(OC)=C1O)C1=[O+]C2=CC(O)=CC(O)=C2C=C1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| CAS ID | 7228-78-6 |
| PubChem ID | 443652 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Pigment of skins of black grapes, also in other plants. Found in red wine. Malvidin glycoside is a biomarker for the consumption of blueberries._x000D_ |
|---|