| Name(s) | (-)-menthol; menthol; menthacamphor |
|---|---|
| Scientific name(s) | l-menthol; 2216-51-5; levomenthol; menthomenthol; l-(-)-menthol; menthacamphor; peppermint camphor; (-)-menthol |
| Formula | C10H20O |
| Molecular mass | 156.269 |
| IUPAC name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| INCHI | InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| SMILE | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
| CAS ID | 89-78-1; 2216-51-5 |
| PubChem ID | 16666 |
| DrugBank ID | DB00825 |
| CHEBI ID | 15409 |
| Description | Present in large amts. in peppermint oil (Mentha piperita), also in other Mentha subspecies. It is used in confectionery and perfumery. Flavouring agent_x000D_ _x000D_ (-)-menthol is the major occuring menthol stereoisomer in nature. (-)-Menthol is found in many foods, some of which are lovage, sweet basil, sweet marjoram, and orange mint. |
|---|