(r)-p-menth-4(8)-en-3-one; pulegone; cyclohexanone, 5-methyl-2-(1-methylethylidene)-
| Name(s) | (r)-p-menth-4(8)-en-3-one; pulegone; cyclohexanone, 5-methyl-2-(1-methylethylidene)- |
|---|---|
| Scientific name(s) | pulegone; p-menth-4(8)-en-3-one; (+-)-pulegone; 4(8)-p-menthen-3-one; 2-isopropylidene-5-methylcyclohexanone; 5-methyl-2-(1-methylethylidene)cyclohexanone |
| Formula | C10H16O |
| Molecular mass | 152.237 |
| IUPAC name | 5-methyl-2-propan-2-ylidenecyclohexan-1-one; (r)-(+)-pulegone |
| INCHI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3 |
| SMILE | CC1CCC(=C(C)C)C(=O)C1 |
| CAS ID | 15932-80-6; 15923-80-6; 89-82-7 |
| PubChem ID | 6988 |
| DrugBank ID | Not available |
| CHEBI ID | 35596 |
| Description | Occurs in oils of Mentha subspecies, Hedeoma pulegioides and many other essential oils. Fragrance and flavour ingredient. (R)-p-Menth-4(8)-en-3-one is found in many foods, some of which are blackcurrant, pepper (c. frutescens), spearmint, and red bell pepper. |
|---|