dillapiole; dillapiol; dill apiole
| Name(s) | dillapiole; dillapiol; dill apiole |
|---|---|
| Scientific name(s) | |
| Formula | C12H14O4 |
| Molecular mass | 222.24 |
| IUPAC name | 4,5-dimethoxy-6-(prop-2-en-1-yl)-2h-1,3-benzodioxole |
| INCHI | InChI=1S/C12H14O4/c1-4-5-8-6-9-11(16-7-15-9)12(14-3)10(8)13-2/h4,6H,1,5,7H2,2-3H3 |
| SMILE | COC1=C(OC)C(CC=C)=CC2=C1OCO2 |
| CAS ID | 484-31-1 |
| PubChem ID | 10231 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of Japanese, Indian (Anethum sowa) and European (Anethum graveolens) dill oils and Piper subspecies Also from seeds of Bunium persicum (black caraway) Dillapiole is an organic chemical compound and essential oil commonly extracted from dill weed, though can be found in a variety of other plants. |
|---|