alpha-tocotrienol; (r)-alpha-tocotrienol
| Name(s) | alpha-tocotrienol; (r)-alpha-tocotrienol |
|---|---|
| Scientific name(s) | d-alpha-tocotrienol; zeta1-tocopherol; (r)-alpha-tocotrienol; d-; a-tocotrienol; (2r,3'e,7'e)-alpha-tocotrienol |
| Formula | C29H44O2 |
| Molecular mass | 424.7 |
| IUPAC name | (2R)-2,5,7,8-tetramethyl-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,4-dihydrochromen-6-ol |
| INCHI | Not available |
| SMILE | CC(C)=CCC\C(C)=C\CC\C(C)=C/CCC1(C)CCC2=C(O1)C(C)=C(C)C(O)=C2C |
| CAS ID | 58864-81-6; 1721-51-3 |
| PubChem ID | 5282347 |
| DrugBank ID | Not available |
| CHEBI ID | 33270 |
| Description | Occurs in wheat, barley, rye and palm oil. Alpha-Tocotrienol is found in the blood plasma and all lipoprotein subfractions.; Compared to tocopherols, alpha- Tocotrienols are poorly studied. Its presence in the blood plasma at nanomolar concentration help to prevent stroke-related neurodegeneration. (PMID: 16771695 ). alpha- Tocotrienol is found to have vitamine E activity. |
|---|