tricetin
| Name(s) | tricetin |
|---|---|
| Scientific name(s) | 5,7,3',4',5'-pentahydroxyflavone; hieracin; 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4h-chromen-4-one; 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one; unii-5627py99zo; 5,7,3,4,5-pentahydroxyflavone |
| Formula | C15H10O7 |
| Molecular mass | 302.23 |
| IUPAC name | 5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| INCHI | Not available |
| SMILE | OC1=CC2=C(C(O)=C1)C(=O)C=C(O2)C1=CC(O)=C(O)C(O)=C1 |
| CAS ID | 520-31-0 |
| PubChem ID | 5281701 |
| DrugBank ID | DB08230 |
| CHEBI ID | Not available |
| Description | Constituent of the seed coat of lentil (Lens culinaris). Tricetin is found in many foods, some of which are ginkgo nuts, pulses, tea, and cereals and cereal products. |
|---|