sequoyitol; 5-o-methyl-myo-inositol
| Name(s) | sequoyitol; 5-o-methyl-myo-inositol |
|---|---|
| Scientific name(s) | sequoyitol; 1d-5-o-methyl-myo-inositol; o-methyl-scyllo-inositol; 1-o-methyl-scyllo-inositol; (1r,2s,4r,5s)-6-methoxycyclohexane-1,2,3,4,5-pentol; (1r,2s,4r,5s)-6-methoxycyclohexane-1,2,3,4,5-pentaol |
| Formula | C7H14O6 |
| Molecular mass | 194.183 |
| IUPAC name | (1s,2r,4s,5r)-6-methoxycyclohexane-1,2,3,4,5-pentol |
| INCHI | Not available |
| SMILE | CO[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@H](O)[C@H]1O |
| CAS ID | 523-92-2 |
| PubChem ID | 439990 |
| DrugBank ID | Not available |
| CHEBI ID | 15975 |
| Description | Occurs in all gymnosperms and two families of dicotyledonsand is also isolated from ferns Nephrolepis auriculata and Nephrolepis biserrata. Sequoyitol is found in soy bean and ginkgo nuts. |
|---|