| Name(s) | isorhamnetin |
|---|---|
| Scientific name(s) | |
| Formula | C16H12O7 |
| Molecular mass | 316.265 |
| IUPAC name | Quercetin 3'-methyl ether |
| INCHI | InChI=1S/C16H12O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 |
| SMILE | COC1=C(O)C=CC(=C1)C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 |
| CAS ID | 480-19-3 |
| PubChem ID | 5281654 |
| DrugBank ID | Not available |
| CHEBI ID | 6052 |
| Description | Widespread flavonol found especially in bee pollen, chives, corn poppy leaves, garden cress, fennel, hartwort, red onions, pears, dillweed, parsley and tarragon. Isorhamnetin is found in many foods, some of which are italian sweet red pepper, carrot, yellow wax bean, and lemon balm. |
|---|