| Name(s) | ethyl benzoate; benzoic acid, ethyl ester |
|---|---|
| Scientific name(s) | 93-89-0; benzoic acid, ethyl ester; benzoic ether; ethyl benzenecarboxylate; benzoyl ethyl ether; benzoic acid ethyl ester; ethylester kyseliny benzoove |
| Formula | C9H10O2 |
| Molecular mass | 150.177 |
| IUPAC name | ethyl benzoate |
| INCHI | InChI=1S/C9H10O2/c1-2-11-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| SMILE | CCOC(=O)C1=CC=CC=C1 |
| CAS ID | 93-89-0 |
| PubChem ID | 7165 |
| DrugBank ID | Not available |
| CHEBI ID | 32807 |
| Description | Found in various fruits, e.g. apple, banana, sweet cherryand is also present in milk, butter, wines, black tea, bourbon vanilla and fruit brandies. Flavouring agent As with many volatile esters, ethyl benzoate has a pleasant odor. It is a component of some artificial fruit flavors.; Ethyl benzoate is the ester formed by the condensation of benzoic acid and ethanol. It is a colorless liquid that is almost insoluble in water, but miscible with most organic solvents. |
|---|