carvone; 2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one
| Name(s) | carvone; 2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one |
|---|---|
| Scientific name(s) | 99-49-0; 2-methyl-5-(prop-1-en-2-yl)cyclohex-2-enone; karvon; 1-carvone; dl-carvone; d-cavone; 2-cyclohexen-1-one, 2-methyl-5-(1-methylethenyl)- |
| Formula | C10H14O |
| Molecular mass | 150.221 |
| IUPAC name | 2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| INCHI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4,9H,1,5-6H2,2-3H3 |
| SMILE | CC(=C)C1CC=C(C)C(=O)C1 |
| CAS ID | 22327-39-5 |
| PubChem ID | 7439 |
| DrugBank ID | Not available |
| CHEBI ID | 38265 |
| Description | Flavouring ingredient. Carvone is found in many foods, some of which are rocket salad (sspecies), caraway, peppermint, and winter savory. |
|---|