methyl salicylate
| Name(s) | methyl salicylate |
|---|---|
| Scientific name(s) | |
| Formula | C8H8O3 |
| Molecular mass | 152.15 |
| IUPAC name | methyl 2-hydroxybenzoate |
| INCHI | InChI=1S/C8H8O3/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5,9H,1H3 |
| SMILE | COC(=O)C1=CC=CC=C1O |
| CAS ID | 119-36-8 |
| PubChem ID | 4133 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Present in white wine, tea, porcini mushroom Boletus edulis, Bourbon vanilla, clary sage, red sage and fruits including cherry, apple, raspberry, papaya and plum. Found in leaves of Gaultheria procumbens (wintergreen). Flavouring agent. |
|---|