piperitenone
| Name(s) | piperitenone |
|---|---|
| Scientific name(s) | |
| Formula | C10H14O |
| Molecular mass | 150.221 |
| IUPAC name | 3-methyl-6-(propan-2-ylidene)cyclohex-2-en-1-one |
| INCHI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)6-10(9)11/h6H,4-5H2,1-3H3 |
| SMILE | CC(C)=C1CCC(C)=CC1=O |
| CAS ID | 491-09-8 |
| PubChem ID | 381152 |
| DrugBank ID | Not available |
| CHEBI ID | 17304 |
| Description | Piperitenone is a flavouring agent. It is found in grapefruit juice lemon juice, orange juice, spearmint oil and peppermint oil. It is also found in rosemary, mentha (mint), cornmint, and other herbs and spices. |
|---|