umbelliferone; 7-hydroxycoumarin; umbelliferon; 7-hydroxycumarin
| Name(s) | umbelliferone; 7-hydroxycoumarin; umbelliferon; 7-hydroxycumarin |
|---|---|
| Scientific name(s) | |
| Formula | C9H6O3 |
| Molecular mass | 162.144 |
| IUPAC name | 7-hydroxy-2h-chromen-2-one |
| INCHI | InChI=1S/C9H6O3/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5,10H |
| SMILE | OC1=CC2=C(C=C1)C=CC(=O)O2 |
| CAS ID | 93-35-6 |
| PubChem ID | 5281426 |
| DrugBank ID | Not available |
| CHEBI ID | 27510 |
| Description | Occurs widely in plants including Angelica subspecies Phytoalexin of infected sweet potato. Umbelliferone is found in many foods, some of which are macadamia nut, silver linden, quince, and capers. |
|---|