hexyl acetate
| Name(s) | hexyl acetate |
|---|---|
| Scientific name(s) | |
| Formula | C8H16O2 |
| Molecular mass | 144.214 |
| IUPAC name | hexyl acetate |
| INCHI | InChI=1S/C8H16O2/c1-3-4-5-6-7-10-8(2)9/h3-7H2,1-2H3 |
| SMILE | CCCCCCOC(C)=O |
| CAS ID | 142-92-7 |
| PubChem ID | 8908 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Hexyl acetate is used in fruit essences and fruit aroma concentrates. It is found in wines, black tea, soya bean, roman camomile, peach, purple mangosteen, and muskmelon. |
|---|