(-)-spathulenol; decahydro-1,1,7-trimethyl-4-methylene-1h-cycloprop[e]azulen-7-ol; spathulenol
| Name(s) | (-)-spathulenol; decahydro-1,1,7-trimethyl-4-methylene-1h-cycloprop[e]azulen-7-ol; spathulenol |
|---|---|
| Scientific name(s) | |
| Formula | C15H24O |
| Molecular mass | 220.356 |
| IUPAC name | 1,1,2-trimethyl-5-methylidene-decahydro-1h-cyclopropa[e]azulen-2-ol |
| INCHI | InChI=1S/C15H24O/c1-9-5-6-11-13(14(11,2)3)12-10(9)7-8-15(12,4)16/h10-13,16H,1,5-8H2,2-4H3 |
| SMILE | CC1(C)C2CCC(=C)C3CCC(C)(O)C3C12 |
| CAS ID | 6750-60-3 |
| PubChem ID | 522266 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of Salvia sclarea (clary sage). Spathulenol is found in many foods, some of which are tarragon, spearmint, common sage, and tea. |
|---|