| Name(s) | 5-methylfurfural; 5-methyl-2-furancarboxaldehyde; 2-furancarboxaldehyde, 5-methyl- |
|---|---|
| Scientific name(s) | 5-methylfurfural; 5-methyl-2-furaldehyde; 5-methylfuran-2-carbaldehyde; 5-methyl furfural; 5-methyl-2-furfural; 2-furancarboxaldehyde, 5-methyl- |
| Formula | C6H6O2 |
| Molecular mass | 110.112 |
| IUPAC name | 5-methylfuran-2-carbaldehyde |
| INCHI | InChI=1S/C6H6O2/c1-5-2-3-6(4-7)8-5/h2-4H,1H3 |
| SMILE | CC1=CC=C(O1)C=O |
| CAS ID | 620-02-0 |
| PubChem ID | 12097 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from brown algae and other plant sources, doubtless as a secondary production from saccharides. Flavouring ingredient. 5-Methyl-2-furancarboxaldehyde is found in many foods, some of which are pepper (c. frutescens), yellow bell pepper, red bell pepper, and pepper (c. annuum). |
|---|