methyl hexanoate; methyl caproate
| Name(s) | methyl hexanoate; methyl caproate |
|---|---|
| Scientific name(s) | |
| Formula | C7H14O2 |
| Molecular mass | 130.187 |
| IUPAC name | methyl hexanoate |
| INCHI | InChI=1S/C7H14O2/c1-3-4-5-6-7(8)9-2/h3-6H2,1-2H3 |
| SMILE | CCCCCC(=O)OC |
| CAS ID | 106-70-7 |
| PubChem ID | 7824 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Present in wine grapes, melon, raspberry, blackberry, plum, quince, apple brandy, wines, Bourbon vanilla, coffee, black tea, potato, tomato, cheeses, rye bread, meats and other foodstuffs. Flavouring agent. Methyl hexanoate is found in many foods, some of which are milk and milk products, fruits, pineapple, and apple. |
|---|