cuparene
| Name(s) | cuparene |
|---|---|
| Scientific name(s) | |
| Formula | C15H22 |
| Molecular mass | 202.34 |
| IUPAC name | 1-methyl-4-[(1r)-1,2,2-trimethylcyclopentyl]benzene |
| INCHI | InChI=1S/C15H22/c1-12-6-8-13(9-7-12)15(4)11-5-10-14(15,2)3/h6-9H,5,10-11H2,1-4H3/t15-/m0/s1 |
| SMILE | CC1=CC=C(C=C1)[C@]1(C)CCCC1(C)C |
| CAS ID | Not available |
| PubChem ID | 86895 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Cuparene is a member of the class of compounds known as sesquiterpenoids. Sesquiterpenoids are terpenes with three consecutive isoprene units. Thus, cuparene is considered to be an isoprenoid lipid molecule. Cuparene can be found in lovage and pepper (spice), which makes cuparene a potential biomarker for the consumption of these food products. |
|---|