| Name(s) | rethinol; retinol; vitamin a |
|---|---|
| Scientific name(s) | vitamin a; afaxin; oleovitamin a |
| Formula | C20H30O |
| Molecular mass | 286.459 |
| IUPAC name | (2e,4e,6z,8e)-3,7-dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-ol |
| INCHI | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8-,17-13+ |
| SMILE | C\C(=C/CO)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C |
| CAS ID | 68-26-8 |
| PubChem ID | 445354 |
| DrugBank ID | DB00162 |
| CHEBI ID | 17336 |
| Description | Constituent of many fish-liver oils, milk, egg-yolk, etc. Nutrient, dietary supplement [DFC]_x000D_ _x000D_ Retinol is one of the animal forms of vitamin A. It is a diterpenoid and an alcohol. It is convertible to other forms of vitamin A, and the retinyl ester derivative of the alcohol serves as the storage form of the vitamin in animals. [Wikipedia]. Retinol is found in many foods, some of which are beer, common wheat, scrapple, and catfish. |
|---|