p-cresol; 4-methylphenol
| Name(s) | p-cresol; 4-methylphenol |
|---|---|
| Scientific name(s) | p-cresol; 4-cresol; 4-hydroxytoluene; phenol, 4-methyl-; p-methylphenol; para-cresol |
| Formula | C7H8O |
| Molecular mass | 108.14 |
| IUPAC name | 4-Methylphenol |
| INCHI | InChI=1S/C7H8O/c1-6-2-4-7(8)5-3-6/h2-5,8H,1H3 |
| SMILE | CC1=CC=C(O)C=C1 |
| CAS ID | 106-44-5 |
| PubChem ID | 2879 |
| DrugBank ID | DB01688 |
| CHEBI ID | 17847 |
| Description | Present in blackcurrant buds, asparagus, cooked cured pork, black tea, fermented tea, yellow passion fruit juice, malt, peated malt, kumazasa (Sasa albo-marginata), lamb's lettuce, squid and cuttlefish. Flavouring ingredient. 4-Methylphenol is found in many foods, some of which are animal foods, cereals and cereal products, tamarind, and tarragon. |
|---|