luteolin
| Name(s) | luteolin |
|---|---|
| Scientific name(s) | 5,7,3',4'-tetrahydroxyflavone |
| Formula | C15H10O6 |
| Molecular mass | 286.239 |
| IUPAC name | 5,7,3',4'-tetrahydroxyflavone |
| INCHI | InChI=1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H |
| SMILE | OC1=CC2=C(C(O)=C1)C(=O)C=C(O2)C1=CC=C(O)C(O)=C1 |
| CAS ID | 491-70-3 |
| PubChem ID | 5280445 |
| DrugBank ID | Not available |
| CHEBI ID | 15864 |
| Description | Flavone v. widespread in plant world; found especies in celery, peppermint, rosemary, thyme and Queen Anne's Lace leaves (wild carrot). Potential nutriceutical. Luteolin is found in many foods, some of which are soy bean, ginger, abalone, and swiss chard. |
|---|