l-limonene; (s)-limonene
| Name(s) | l-limonene; (s)-limonene |
|---|---|
| Scientific name(s) | (s)-limonene |
| Formula | C10H16 |
| Molecular mass | 136.238 |
| IUPAC name | (4s)-1-methyl-4-prop-1-en-2-ylcyclohexene |
| INCHI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| SMILE | CC(=C)[C@@H]1CCC(C)=CC1 |
| CAS ID | 5989-54-8 |
| PubChem ID | 439250 |
| DrugBank ID | Not available |
| CHEBI ID | 15383 |
| Description | Constituent of pine needle oiland is) also present in ginger, nutmeg, pepper, mace, coriander and other herbs and spices. (S)-Limonene is found in many foods, some of which are fennel, caraway, cardamom, and herbs and spices. |
|---|