bicyclogermacrene
| Name(s) | bicyclogermacrene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.357 |
| IUPAC name | (2z,6z)-3,7,11,11-tetramethylbicyclo[8.1.0]undeca-2,6-diene |
| INCHI | InChI=1S/C15H24/c1-11-6-5-7-12(2)10-14-13(9-8-11)15(14,3)4/h6,10,13-14H,5,7-9H2,1-4H3/b11-6-,12-10- |
| SMILE | C\C1=C\CC\C(C)=C/C2C(CC1)C2(C)C |
| CAS ID | 24703-35-3 |
| PubChem ID | 5315347 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of the peel oil of Citrus junos (yuzu). Bicyclogermacrene is found in many foods, some of which are common oregano, lemon balm, hyssop, and orange mint. |
|---|