esculetin; aesculetin
| Name(s) | esculetin; aesculetin |
|---|---|
| Scientific name(s) | esculetin; 6,7-dihydroxycoumarin; 6,7-dihydroxy-2h-chromen-2-one; cichorigenin; esculetol; cichoriin aglucon |
| Formula | C9H6O4 |
| Molecular mass | 178.143 |
| IUPAC name | 6,7-dihydroxychromen-2-one; 6,7-dihydroxy-2h-chromen-2-one |
| INCHI | InChI=1S/C9H6O4/c10-6-3-5-1-2-9(12)13-8(5)4-7(6)11/h1-4,10-11H |
| SMILE | OC1=C(O)C=C2C=CC(=O)OC2=C1 |
| CAS ID | 305-01-1 |
| PubChem ID | 5281416 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Metabolite of infected sweet potato. Aesculetin is found in many foods, some of which are root vegetables, wild carrot, sweet basil, and carrot. |
|---|