1,2-benzenediol; catechol; benzene-1,2-diol
| Name(s) | 1,2-benzenediol; catechol; benzene-1,2-diol |
|---|---|
| Scientific name(s) | pyrocatechol; catechol; 1,2-dihydroxybenzene; benzene-1,2-diol; pyrocatechin; 2-hydroxyphenol; 1,2-benzenediol |
| Formula | C6H6O2 |
| Molecular mass | 110.11064 |
| IUPAC name | benzene-1,2-diol |
| INCHI | InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
| SMILE | OC1=CC=CC=C1O |
| CAS ID | 120-80-9 |
| PubChem ID | 289 |
| DrugBank ID | DB02232 |
| CHEBI ID | 18135 |
| Description | Constituent of variety foodstuffs especies coffee, cocoa, bread crust, roasted malt and beer; Isolated from various plant sources and by hydrolysis of tannins (CCD). 1,2-Benzenediol is found in many foods, some of which are chervil, black raspberry, swede, and wasabi. |
|---|