gallocatechin; (+)-gallocatechin
| Name(s) | gallocatechin; (+)-gallocatechin |
|---|---|
| Scientific name(s) | gallocatechin |
| Formula | C15H14O7 |
| Molecular mass | 306.27 |
| IUPAC name | (2r,3s)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2h-chromene-3,5,7-triol |
| INCHI | InChI=1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15+/m0/s1 |
| SMILE | O[C@H]1CC2=C(O)C=C(O)C=C2O[C@@H]1C1=CC(O)=C(O)C(O)=C1 |
| CAS ID | 970-73-0 |
| PubChem ID | 65084 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Widespread in plants; found especies in green tea, redcurrants, gooseberries and marrowfat peas. Potential nutriceutical. Gallocatechin is found in many foods, some of which are broad bean, broccoli, quince, and common grape. |
|---|