| Name(s) | astragalin; kaempferol 3-o-glucoside; kaempferol-3-o-glucoside |
|---|---|
| Scientific name(s) | |
| Formula | C21H20O11 |
| Molecular mass | 448.38 |
| IUPAC name | kaempferol-3-o-β-d-glucopyranoside |
| INCHI | InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
| SMILE | OC[C@H]1O[C@@H](OC2=C(OC3=CC(O)=CC(O)=C3C2=O)C2=CC=C(O)C=C2)[C@H](O)[C@@H](O)[C@@H]1O |
| CAS ID | 480-10-4 |
| PubChem ID | 5282102 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Present in red wine. Isolated from many plant subspecies_x000D_ _x000D_ Astragalin is a 3-O-glucoside of kaempferol.; Astragalin is a chemical compound. It can be isolated from Phytolacca americana (the American pokeweed). Astragalin is found in many foods, some of which are sunflower, black elderberry, loganberry, and yellow zucchini. |
|---|