| Name(s) | [4]-gingerdiol |
|---|---|
| Scientific name(s) | |
| Formula | C15H24O4 |
| Molecular mass | 268.3487 |
| IUPAC name | 1-(4-hydroxy-3-methoxyphenyl)octane-3,5-diol |
| INCHI | InChI=1S/C15H24O4/c1-3-4-12(16)10-13(17)7-5-11-6-8-14(18)15(9-11)19-2/h6,8-9,12-13,16-18H,3-5,7,10H2,1-2H3 |
| SMILE | CCCC(O)CC(O)CCC1=CC(OC)=C(O)C=C1 |
| CAS ID | 53254-75-4 |
| PubChem ID | 5318276 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | [4]-gingerdiol is a member of the class of compounds known as gingerdiols. Gingerdiols are compounds containing a gingerdiol moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by an alkane-2,4-diol. [4]-gingerdiol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [4]-gingerdiol can be found in ginger, which makes [4]-gingerdiol a potential biomarker for the consumption of this food product. |
|---|