beta-bisabolol
| Name(s) | beta-bisabolol |
|---|---|
| Scientific name(s) | .beta.-bisabolol; 3-cyclohexen-1-ol, 1-(1,5-dimethyl-4-hexenyl)-4-methyl-; 4-methyl-1-(6-methylhept-5-en-2-yl)cyclohex-3-en-1-ol; schembl6519813; 4-methyl-1-(6-methylhept-5-en-2-yl)cyclohex-3-enol |
| Formula | C15H26O |
| Molecular mass | 222.37 |
| IUPAC name | 4-methyl-1-(6-methylhept-5-en-2-yl)cyclohex-3-en-1-ol |
| INCHI | InChI=1S/C15H26O/c1-12(2)6-5-7-14(4)15(16)10-8-13(3)9-11-15/h6,8,14,16H,5,7,9-11H2,1-4H3/t14-,15+/m0/s1 |
| SMILE | C[C@@H](CCC=C(C)C)[C@]1(O)CCC(C)=CC1 |
| CAS ID | 15352-77-9 |
| PubChem ID | 27208 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of Gossypium hirsutum (cotton) oil and other essential oils. beta-Bisabolol is found in fats and oils, pepper (spice), and ginger. |
|---|