| Name(s) | alpha-selinene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.357 |
| IUPAC name | 4a,8-dimethyl-2-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| INCHI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3 |
| SMILE | CC(=C)C1CCC2(C)CCC=C(C)C2C1 |
| CAS ID | 473-13-2 |
| PubChem ID | 10856614 |
| DrugBank ID | Not available |
| CHEBI ID | 59961 |
| Description | Occurs in celery oil and hop (Humulus lupulus) oil. alpha-Selinene is found in many foods, some of which are ginger, lovage, sweet bay, and allspice. |
|---|