folic acid
| Name(s) | folic acid |
|---|---|
| Scientific name(s) | |
| Formula | C19H19N7O6 |
| Molecular mass | 441.41 |
| IUPAC name | (2s)-2-[(4-{[(2-amino-4-hydroxypteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid |
| INCHI | InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1 |
| SMILE | NC1=NC(=O)C2=NC(CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)=CN=C2N1 |
| CAS ID | 59-30-3 |
| PubChem ID | 135398658 |
| DrugBank ID | DB00158 |
| CHEBI ID | 27470 |
| Description | Dietary supplement_x000D_ _x000D_ Folic acid (also known as vitamin B9, vitamin Bc or folacin) and folate (the naturally occurring form), as well as pteroyl-L-glutamic acid, pteroyl-L-glutamate, and pteroylmonoglutamic acid are forms of the water-soluble vitamin B9. [Wikipedia]. Folic acid is found in many foods, some of which are leavening agent, crisp bread, walleye, and stew. |
|---|