| Name(s) | l-cysteine |
|---|---|
| Scientific name(s) | cysteine; thioserine; (r)-2-amino-3-mercaptopropanoic acid; cystein; half-cystine; (r)-cysteine |
| Formula | C3H7NO2S |
| Molecular mass | 121.16 |
| IUPAC name | (2R)-2-amino-3-sulfanylpropanoic acid |
| INCHI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
| SMILE | N[C@@H](CS)C(O)=O |
| CAS ID | 52-90-4 |
| PubChem ID | 5862 |
| DrugBank ID | DB00151 |
| CHEBI ID | 17561 |
| Description | Detoxicant, dietary supplement, dough strengthener, yeast nutrient for leavened bakery products. Flavouring agent. Enzymic browning inhibitor. L-Cysteine is found in many foods, some of which are bilberry, mugwort, cowpea, and sweet bay. |
|---|