(z)-methyl isoeugenol; methylisoeugenol
| Name(s) | (z)-methyl isoeugenol; methylisoeugenol |
|---|---|
| Scientific name(s) | cis-methylisoeugenol; cis-methyl isoeugenol; isoeugenyl methyl ether; cis-4-propenyl veratrole; methyl isoeugenol; o-methylisoeugenol; (z)-methylisoeugenol |
| Formula | C11H14O2 |
| Molecular mass | 178.23 |
| IUPAC name | 1,2-dimethoxy-4-[(Z)-prop-1-enyl]benzene |
| INCHI | InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4-8H,1-3H3/b5-4- |
| SMILE | COC1=C(OC)C=C(\C=C/C)C=C1 |
| CAS ID | 6380-24-1; 6379-72-2 |
| PubChem ID | 1549045 |
| DrugBank ID | Not available |
| CHEBI ID | 6877 |
| Description | Constituent of essential oils. Flavouring ingredient. Methylisoeugenol is found in many foods, some of which are star anise, sweet basil, wild carrot, and tarragon. |
|---|