| Name(s) | d-fructose |
|---|---|
| Scientific name(s) | |
| Formula | C18H36O18 |
| Molecular mass | 540.4676 |
| IUPAC name | 1,3,4,5,6-pentahydroxyhexan-2-one; 2,5-bis(hydroxymethyl)oxolane-2,3,4-triol; 2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| INCHI | InChI=1S/3C6H12O6/c7-2-6(11)5(10)4(9)3(8)1-12-6;7-1-3-4(9)5(10)6(11,2-8)12-3;7-1-3(9)5(11)6(12)4(10)2-8/h2*3-5,7-11H,1-2H2;3,5-9,11-12H,1-2H2 |
| SMILE | OCC(O)C(O)C(O)C(=O)CO.OCC1OC(O)(CO)C(O)C1O.OCC1(O)OCC(O)C(O)C1O |
| CAS ID | 53188-23-1 |
| PubChem ID | 439709 |
| DrugBank ID | Not available |
| CHEBI ID | 48095 |
| Description | D-Fructose occurs in honey and a large number of fruits, particularly apples and tomatoes. It is fluid and nutrient replenisher, and nutritive sweetener. Inulin from dandelion roots has also been used as a source. Present in polymeric form in the inulins, the energy reserve polysaccharides of many plants, e.g. dahlia and Jerusalem artichoke tubers. D-Fructose is also found in many other foods, some of which are sweet cherry, anise, and tinda. |
|---|