ethyl tetradecanoate; ethyl myristate
| Name(s) | ethyl tetradecanoate; ethyl myristate |
|---|---|
| Scientific name(s) | ethyl myristate; tetradecanoic acid, ethyl ester; myristic acid ethyl ester; myristic acid, ethyl ester; ethyl n-tetradecanoate; mfcd00008984 |
| Formula | C16H32O2 |
| Molecular mass | 256.43 |
| IUPAC name | ethyl tetradecanoate |
| INCHI | InChI=1S/C16H32O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16(17)18-4-2/h3-15H2,1-2H3 |
| SMILE | CCCCCCCCCCCCCC(=O)OCC |
| CAS ID | 124-06-1 |
| PubChem ID | 31283 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Flavouring agent. Ethyl tetradecanoate is found in many foods, some of which are coriander, ginger, sweet marjoram, and guava. |
|---|