chavicol; 4-allylphenol
| Name(s) | chavicol; 4-allylphenol |
|---|---|
| Scientific name(s) | 4-allylphenol; 501-92-8; p-allylphenol; p-hydroxyallylbenzene; phenol, 4-(2-propenyl)-; 4-prop-2-enylphenol; phenol, p-allyl-; chavicol |
| Formula | C9H10O |
| Molecular mass | 134.178 |
| IUPAC name | 4-prop-2-enylphenol |
| INCHI | InChI=1S/C9H10O/c1-2-3-8-4-6-9(10)7-5-8/h2,4-7,10H,1,3H2 |
| SMILE | OC1=CC=C(CC=C)C=C1 |
| CAS ID | 501-92-8 |
| PubChem ID | 68148 |
| DrugBank ID | Not available |
| CHEBI ID | 50158 |
| Description | Found in many essential oils, e.g. anise and Gardenia. It is used in perfumery and flavours. |
|---|