(s)-[10]-gingerol
| Name(s) | (s)-[10]-gingerol |
|---|---|
| Scientific name(s) | 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradecan-3-one; 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-tetradecanone; 107257-18-1; chembl3883497; schembl4885722; chebi:175490; bdbm50210068 |
| Formula | C21H34O4 |
| Molecular mass | 350.5 |
| IUPAC name | 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)tetradecan-3-one |
| INCHI | InChI=1S/C21H34O4/c1-3-4-5-6-7-8-9-10-18(22)16-19(23)13-11-17-12-14-20(24)21(15-17)25-2/h12,14-15,18,22,24H,3-11,13,16H2,1-2H3 |
| SMILE | CCCCCCCCCC(O)CC(=O)CCC1=CC(OC)=C(O)C=C1 |
| CAS ID | 23513-15-7 |
| PubChem ID | 5275726 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of ginger, the rhizome of Zingiber officinale. (S)-[10]-Gingerol is found in herbs and spices and ginger. |
|---|