| Name(s) | methyl-[8]-gingerol |
|---|---|
| Scientific name(s) | methyl-8-gingerol; chembl4098252; schembl20668185; chebi:192219; 1-(3,4-dimethoxyphenyl)-5-hydroxydodecan-3-one |
| Formula | C20H32O4 |
| Molecular mass | 336.4657 |
| IUPAC name | 1-(3,4-dimethoxyphenyl)-5-hydroxydodecan-3-one |
| INCHI | InChI=1S/C20H32O4/c1-4-5-6-7-8-9-17(21)15-18(22)12-10-16-11-13-19(23-2)20(14-16)24-3/h11,13-14,17,21H,4-10,12,15H2,1-3H3 |
| SMILE | CCCCCCCC(O)CC(=O)CCC1=CC=C(OC)C(OC)=C1 |
| CAS ID | Not available |
| PubChem ID | 86217089 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Methyl-[8]-gingerol is a member of the class of compounds known as dimethoxybenzenes. Dimethoxybenzenes are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. Methyl-[8]-gingerol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Methyl-[8]-gingerol can be found in ginger, which makes methyl-[8]-gingerol a potential biomarker for the consumption of this food product. |
|---|