| Name(s) | methyl-[12]-gingerol |
|---|---|
| Scientific name(s) | |
| Formula | C24H40O4 |
| Molecular mass | 392.572 |
| IUPAC name | 1-(3,4-dimethoxyphenyl)-5-hydroxyhexadecan-3-one |
| INCHI | InChI=1S/C24H40O4/c1-4-5-6-7-8-9-10-11-12-13-21(25)19-22(26)16-14-20-15-17-23(27-2)24(18-20)28-3/h15,17-18,21,25H,4-14,16,19H2,1-3H3 |
| SMILE | CCCCCCCCCCCC(O)CC(=O)CCC1=CC=C(OC)C(OC)=C1 |
| CAS ID | Not available |
| PubChem ID | 157010033 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Methyl-[12]-gingerol is a member of the class of compounds known as dimethoxybenzenes. Dimethoxybenzenes are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. Methyl-[12]-gingerol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Methyl-[12]-gingerol can be found in ginger, which makes methyl-[12]-gingerol a potential biomarker for the consumption of this food product. |
|---|