| Name(s) | methyl-[10]-gingerol |
|---|---|
| Scientific name(s) | methyl-10-gingerol; chebi:191431; 1-(3,4-dimethoxyphenyl)-5-hydroxytetradecan-3-one |
| Formula | C22H36O4 |
| Molecular mass | 364.5188 |
| IUPAC name | 1-(3,4-dimethoxyphenyl)-5-hydroxytetradecan-3-one |
| INCHI | InChI=1S/C22H36O4/c1-4-5-6-7-8-9-10-11-19(23)17-20(24)14-12-18-13-15-21(25-2)22(16-18)26-3/h13,15-16,19,23H,4-12,14,17H2,1-3H3 |
| SMILE | CCCCCCCCCC(O)CC(=O)CCC1=CC=C(OC)C(OC)=C1 |
| CAS ID | Not available |
| PubChem ID | 86181346 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Methyl-[10]-gingerol is a member of the class of compounds known as dimethoxybenzenes. Dimethoxybenzenes are organic aromatic compounds containing a monocyclic benzene moiety carrying exactly two methoxy groups. Methyl-[10]-gingerol is practically insoluble (in water) and an extremely weak acidic compound (based on its pKa). Methyl-[10]-gingerol can be found in ginger, which makes methyl-[10]-gingerol a potential biomarker for the consumption of this food product. |
|---|