| Name(s) | 3-phenyl benzaldehyde |
|---|---|
| Scientific name(s) | 3-phenylbenzaldehyde; [1,1'-biphenyl]-3-carbaldehyde; biphenyl-3-carbaldehyde; biphenyl-3-carboxaldehyde; 3-difenilaldeide [italian]; 1,1'-biphenyl-3-carbaldehyde; 3-formylbiphenyl |
| Formula | C13H10O |
| Molecular mass | 182.22 |
| IUPAC name | 3-phenylbenzaldehyde |
| INCHI | InChI=1S/C13H10O/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-10H |
| SMILE | O=CC1=CC=CC(=C1)C1=CC=CC=C1 |
| CAS ID | 1204-60-0 |
| PubChem ID | 121053 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | 3-phenyl benzaldehyde belongs to biphenyls and derivatives class of compounds. Those are organic compounds containing to benzene rings linked together by a C-C bond. 3-phenyl benzaldehyde is practically insoluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). 3-phenyl benzaldehyde can be found in ginger, which makes 3-phenyl benzaldehyde a potential biomarker for the consumption of this food product. |
|---|