| Name(s) | [16]-gingerol |
|---|---|
| Scientific name(s) | |
| Formula | C27H46O4 |
| Molecular mass | 434.6517 |
| IUPAC name | 5-hydroxy-1-(4-hydroxy-3-methoxyphenyl)icosan-3-one |
| INCHI | InChI=1S/C27H46O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-24(28)22-25(29)19-17-23-18-20-26(30)27(21-23)31-2/h18,20-21,24,28,30H,3-17,19,22H2,1-2H3 |
| SMILE | CCCCCCCCCCCCCCCC(O)CC(=O)CCC1=CC=C(O)C(OC)=C1 |
| CAS ID | Not available |
| PubChem ID | 24826530 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | [16]-gingerol is a member of the class of compounds known as gingerols. Gingerols are compounds containing a gingerol moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by a 5-hydroxy-alkane-3-one. [16]-gingerol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [16]-gingerol can be found in ginger, which makes [16]-gingerol a potential biomarker for the consumption of this food product. |
|---|