| Name(s) | [12]-gingerdiol |
|---|---|
| Scientific name(s) | |
| Formula | C23H40O4 |
| Molecular mass | 380.5613 |
| IUPAC name | 1-(4-hydroxy-3-methoxyphenyl)hexadecane-3,5-diol |
| INCHI | InChI=1S/C23H40O4/c1-3-4-5-6-7-8-9-10-11-12-20(24)18-21(25)15-13-19-14-16-22(26)23(17-19)27-2/h14,16-17,20-21,24-26H,3-13,15,18H2,1-2H3 |
| SMILE | CCCCCCCCCCCC(O)CC(O)CCC1=CC(OC)=C(O)C=C1 |
| CAS ID | 402-45-9 |
| PubChem ID | 86196540 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | [12]-gingerdiol is a member of the class of compounds known as gingerdiols. Gingerdiols are compounds containing a gingerdiol moiety, which is structurally characterized by a 4-hydroxy-3-methoxyphenyl group substituted at the C6 carbon atom by an alkane-2,4-diol. [12]-gingerdiol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [12]-gingerdiol can be found in ginger, which makes [12]-gingerdiol a potential biomarker for the consumption of this food product. |
|---|