| Name(s) | beta-himachalene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.357 |
| IUPAC name | 3,5,5,9-tetramethyl-2,4a,5,6,7,8-hexahydro-1h-benzo[7]annulene |
| INCHI | InChI=1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h10,14H,5-9H2,1-4H3 |
| SMILE | CC1=CC2C(CC1)=C(C)CCCC2(C)C |
| CAS ID | Not available |
| PubChem ID | 15095 |
| DrugBank ID | Not available |
| CHEBI ID | 49210 |
| Description | Beta-himachalene is a member of the class of compounds known as himachalane and lippifoliane sesquiterpenoids. Himachalane and lippifoliane sesquiterpenoids are diterpenoids with a structure based on either the himachalane or the lippifoliane skeleton. Thus, beta-himachalene is considered to be an isoprenoid lipid molecule. Beta-himachalene can be found in anise and ginger, which makes beta-himachalene a potential biomarker for the consumption of these food products. |
|---|