calamenene
| Name(s) | calamenene |
|---|---|
| Scientific name(s) | |
| Formula | C15H22 |
| Molecular mass | 202.3352 |
| IUPAC name | 1,6-dimethyl-4-(propan-2-yl)-1,2,3,4-tetrahydronaphthalene |
| INCHI | InChI=1S/C15H22/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5,7,9-10,12-13H,6,8H2,1-4H3 |
| SMILE | CC(C)C1CCC(C)C2=CC=C(C)C=C12 |
| CAS ID | 1406-50-4 |
| PubChem ID | 10224 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | (e)-calamene is also known as calamenene or 1,6-dimethyl-4-isopropyltetralin. (e)-calamene can be found in a number of food items such as guava, lovage, summer savory, and rosemary, which makes (e)-calamene a potential biomarker for the consumption of these food products (e)-calamene can be found primarily in urine. |
|---|