[8]-gingerdiol
| Name(s) | [8]-gingerdiol |
|---|---|
| Scientific name(s) | schembl23370853 |
| Formula | C23H36O6 |
| Molecular mass | 408.5 |
| IUPAC name | [3-acetyloxy-1-(4-hydroxy-3-methoxyphenyl)dodecan-5-yl] acetate |
| INCHI | InChI=1S/C23H36O6/c1-5-6-7-8-9-10-20(28-17(2)24)16-21(29-18(3)25)13-11-19-12-14-22(26)23(15-19)27-4/h12,14-15,20-21,26H,5-11,13,16H2,1-4H3 |
| SMILE | CCCCCCCC(CC(CCC1=CC=C(O)C(OC)=C1)OC(C)=O)OC(C)=O |
| CAS ID | 863780-91-0 |
| PubChem ID | 156373480 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | [8]-gingerdiol is a member of the class of compounds known as fatty alcohol esters. Fatty alcohol esters are ester derivatives of a fatty alcohol. [8]-gingerdiol is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). [8]-gingerdiol can be found in ginger, which makes [8]-gingerdiol a potential biomarker for the consumption of this food product. |
|---|