6-gingesulfonic acid
| Name(s) | 6-gingesulfonic acid |
|---|---|
| Scientific name(s) | |
| Formula | C17H26O6S |
| Molecular mass | 358.449 |
| IUPAC name | 1-(4-hydroxy-3-methoxyphenyl)-3-oxodecane-5-sulfonic acid |
| INCHI | InChI=1S/C17H26O6S/c1-3-4-5-6-15(24(20,21)22)12-14(18)9-7-13-8-10-16(19)17(11-13)23-2/h8,10-11,15,19H,3-7,9,12H2,1-2H3,(H,20,21,22) |
| SMILE | CCCCCC(CC(=O)CCC1=CC(OC)=C(O)C=C1)S(O)(=O)=O |
| CAS ID | 145937-21-9 |
| PubChem ID | 126890 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Isolated from the rhizome of Zingiber officinale (ginger). 6-Gingesulfonic acid is found in herbs and spices and ginger. |
|---|