| Name(s) | gamma-muurolene |
|---|---|
| Scientific name(s) | |
| Formula | C15H24 |
| Molecular mass | 204.357 |
| IUPAC name | 7-methyl-4-methylidene-1-(propan-2-yl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| INCHI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13-15H,4-8H2,1-3H3 |
| SMILE | CC(C)C1CCC(=C)C2CCC(C)=CC12 |
| CAS ID | 24268-39-1 |
| PubChem ID | 12313020 |
| DrugBank ID | Not available |
| CHEBI ID | Not available |
| Description | Constituent of Pinus sylvestris (Scotch pine). gamma-Muurolene is found in many foods, some of which are sweet basil, winter savory, orange mint, and carrot. |
|---|